| Melting point |
51-53 °C (lit.) |
| Boiling point |
80-85 °C/0.2 mmHg (lit.) |
| Flash point |
144 °F |
| storage temp. |
Sealed in dry,2-8°C |
| form |
crystal |
| color |
orange |
| Water Solubility |
Insoluble in water. |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| Exposure limits |
ACGIH: TWA 1 mg/m3
NIOSH: TWA 1 mg/m3 |
| Stability |
Stable. Highly flammable. Incompatible with strong acids, strong oxidizing agents. |
| InChI |
InChI=1S/C7H7.C5H5.Fe/c1-2-7-5-3-4-6-7;1-2-4-5-3-1;/h2-6H,1H2;1-5H; |
| InChIKey |
LCPVTGDQYVLJHU-UHFFFAOYSA-N |
| SMILES |
[C]1(C=C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,3,4,5,6,7,8,9,10,11| |
| NIST Chemistry Reference |
Vinylferrocene(1271-51-8) |
