Lithium bis(trimethylsilyl)amide
- Product NameLithium bis(trimethylsilyl)amide
- CAS4039-32-1
- CBNumberCB2202677
- MFC6H18LiNSi2
- MW167.33
- EINECS223-725-6
- MDL NumberMFCD00008261
- MOL File4039-32-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 73°C |
| Boiling point | 55-56 °C |
| Density | 0.860 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 48 °F |
| storage temp. | Store below +30°C. |
| solubility | hydrolysis |
| form | Powder |
| color | White |
| Specific Gravity | 0.716 |
| Water Solubility | hydrolysis |
| Sensitive | Air & Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3567910 |
| Major Application | battery precursors catalysts material synthesis precursor |
| InChI | 1S/C6H18NSi2.Li/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | YNESATAKKCNGOF-UHFFFAOYSA-N |
| SMILES | [Li]N([Si](C)(C)C)[Si](C)(C)C |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H251-H314 | |||||||||
| Precautionary statements | P210-P235-P260-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | F,C,N | |||||||||
| Risk Statements | 11-34-48/20-63-65-67-51/53-35-20-62-14-40-37-19 | |||||||||
| Safety Statements | 9-16-26-29-33-36/37/39-45-61-62-57-43 | |||||||||
| RIDADR | UN 2925 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Flam. Sol. 1 Self-heat. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
