Trimethyl(phenoxy)silane
- Product NameTrimethyl(phenoxy)silane
- CAS1529-17-5
- CBNumberCB4402745
- MFC9H14OSi
- MW166.29
- EINECS216-211-8
- MDL NumberMFCD00053666
- MOL File1529-17-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -55 °C |
| Boiling point | 81 °C23 mm Hg(lit.) |
| Density | 0.92 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 127 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| Specific Gravity | 0.92 |
| color | Colorless to Light orange to Yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| λmax | 274nm(Heptane)(lit.) |
| BRN | 1905943 |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)10-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | OJAJJFGMKAZGRZ-UHFFFAOYSA-N |
| SMILES | C1(O[Si](C)(C)C)=CC=CC=C1 |
| FDA UNII | 85E4MFC32D |
| EPA Substance Registry System | Silane, trimethylphenoxy- (1529-17-5) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|



