2,3-Dinitrotoluene
- Product Name2,3-Dinitrotoluene
- CAS602-01-7
- CBNumberCB1105975
- MFC7H6N2O4
- MW182.13
- EINECS210-013-5
- MDL NumberMFCD00007178
- MOL File602-01-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 59-61 °C (lit.) |
| Boiling point | 315.51°C (rough estimate) |
| Density | 1.5181 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| BRN | 2212428 |
| Henry's Law Constant | 1.1×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C7H6N2O4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3 |
| InChIKey | DYSXLQBUUOPLBB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(c1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 602-01-7(CAS DataBase Reference) |
| EWG's Food Scores | 5 |
| FDA UNII | BS660NHC83 |
| EPA Substance Registry System | 2,3-Dinitrotoluene (602-01-7) |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
![]() ![]()
|
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H341-H350-H361f-H373-H410-H301-H311-H331 |
| Precautionary statements | P201-P261-P273-P280-P301+P310-P311 |
| Hazard Codes | T,N,Xi |
| Risk Statements | 45-23/24/25-48/22-50/53-62-68-36/37/38 |
| Safety Statements | 53-45-60-61-36-26 |
| RIDADR | UN 3454 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | XT1400000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 2 Repr. 2 STOT RE 2 |
| Hazardous Substances Data | 602-01-7(Hazardous Substances Data) |


