Chlorodimethylpentafluorophenylsilane
- Product NameChlorodimethylpentafluorophenylsilane
- CAS20082-71-7
- CBNumberCB8853291
- MFC8H6ClF5Si
- MW260.66
- EINECS243-506-9
- MDL NumberMFCD00000500
- MOL File20082-71-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 50-55 °C(lit.) |
| Boiling point | 89 °C |
| Density | 1.384 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 167 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.384 |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 2858407 |
| InChI | InChI=1S/C8H6ClF5Si/c1-15(2,9)8-6(13)4(11)3(10)5(12)7(8)14/h1-2H3 |
| InChIKey | PQRFRTCWNCVQHI-UHFFFAOYSA-N |
| SMILES | C1([Si](Cl)(C)C)=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 20082-71-7(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, chlorodimethyl(pentafluorophenyl)- (20082-71-7) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| Hazard Codes | T,Xi,C,F | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 36/37-45-36/37/39-26 | |||||||||
| RIDADR | UN 2987 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | XS9065000 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| NFPA 704: |
|