1,3-Dinitro-2-chloro-5-trifluoromethylbenzene
- Product Name1,3-Dinitro-2-chloro-5-trifluoromethylbenzene
- CAS393-75-9
- CBNumberCB1329205
- MFC7H2ClF3N2O4
- MW270.55
- EINECS206-889-3
- MDL NumberMFCD00007068
- MOL File393-75-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 50-55 °C (lit.) |
| Boiling point | >250°C |
| Density | 1.6 |
| Flash point | 126°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| BRN | 1220937 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H2ClF3N2O4/c8-6-4(12(14)15)1-3(7(9,10)11)2-5(6)13(16)17/h1-2H |
| InChIKey | HFHAVERNVFNSHL-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(c1Cl)[N+]([O-])=O)C(F)(F)F |
| LogP | 2.5 |
| CAS DataBase Reference | 393-75-9(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H310-H315-H319 | |||||||||
| Precautionary statements | P262-P280-P301+P312+P330-P302+P352+P310-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 22-24-36/37/38 | |||||||||
| Safety Statements | 36/37-45-36-26 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | XS9065000 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049085 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 | |||||||||
| Hazardous Substances Data | 393-75-9(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
