Lithium acetate
- Product NameLithium acetate
- CAS546-89-4
- CBNumberCB0479202
- MFC2H3LiO2
- MW65.99
- EINECS208-914-3
- MDL NumberMFCD00013057
- MOL File546-89-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 283-285 °C (lit.) |
| Density | 1.3[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 5 M at 20 °C, clear, colorless |
| form | Powder or Crystals |
| color | White to yellow |
| Water Solubility | 40.8 g/100 mL (20 ºC) |
| Merck | 14,5521 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | battery precursors catalysts material synthesis precursor |
| InChI | InChI=1S/C2H4O2.Li/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | XIXADJRWDQXREU-UHFFFAOYSA-M |
| SMILES | C([O-])(=O)C.[Li+] |
| LogP | 0.09 at 25℃ |
| CAS DataBase Reference | 546-89-4(CAS DataBase Reference) |
| FDA UNII | H4278O5FLV |
| EPA Substance Registry System | Lithium acetate (546-89-4) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36 | |||||||||
| Safety Statements | 23-24/25-39-26-22 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | AI5450000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29152990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 | |||||||||
| NFPA 704: |
|
