3-Nitrophthalonitrile
- Product Name3-Nitrophthalonitrile
- CAS51762-67-5
- CBNumberCB0111029
- MFC8H3N3O2
- MW173.13
- EINECS450-650-8
- MDL NumberMFCD00191558
- MOL File51762-67-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 162-165 °C (lit.) |
| Boiling point | 386.1±37.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20-25℃ |
| storage temp. | room temp |
| form | Powder |
| color | White to Light yellow to Green |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 2263686 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C8H3N3O2/c9-4-6-2-1-3-8(11(12)13)7(6)5-10/h1-3H |
| InChIKey | UZJZIZFCQFZDHP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC=CC([N+]([O-])=O)=C1C#N |
| LogP | 0.3 at 25℃ |
| Surface tension | 70.3mN/m at 212.5mg/L and 25℃ |
| CAS DataBase Reference | 51762-67-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Benzenedicarbonitrile, 3-nitro- (51762-67-5) |
| UNSPSC Code | 12171500 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-36-45-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | CZ1953200 | |||||||||
| HS Code | 29269090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

