51762-67-5
| Name | 3-Nitrophthalonitrile |
| CAS | 51762-67-5 |
| EINECS(EC#) | -0 |
| Molecular Formula | C8H3N3O2 |
| MDL Number | MFCD00191558 |
| Molecular Weight | 173.13 |
| MOL File | 51762-67-5.mol |
Chemical Properties
| Appearance | light yellow powder |
| Melting point | 162-165 °C (lit.) |
| Boiling point | 386.1±37.0 °C(Predicted) |
| density | 1.41±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20-25℃ |
| storage temp. | room temp |
| form | Powder |
| color | White to Light yellow to Green |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 2263686 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C8H3N3O2/c9-4-6-2-1-3-8(11(12)13)7(6)5-10/h1-3H |
| InChIKey | UZJZIZFCQFZDHP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC=CC([N+]([O-])=O)=C1C#N |
| LogP | 0.3 at 25℃ |
| Surface tension | 70.3mN/m at 212.5mg/L and 25℃ |
| CAS DataBase Reference | 51762-67-5(CAS DataBase Reference) |
| EPA Substance Registry System | 51762-67-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CZ1953200 |
| REACH Registrations | Inactive |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
