Kaolin Clay
- Product NameKaolin Clay
- CAS1332-58-7
- CBNumberCB00129645
- MFH2Al2O8Si2.H2O
- MW258.16
- EINECS310-194-1
- MDL NumberMFCD00062311
- MOL File1332-58-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 1750 °C |
| Density | 2,6 g/cm3 |
| refractive index | 1.6200 |
| storage temp. | no restrictions. |
| solubility | Practically insoluble in diethyl ether, ethanol (95%), water, other organic solvents, cold dilute acids, and solutions of alkali hydroxides. |
| form | Powder |
| color | 75-96, Hunter Brightness |
| PH | 6-7 (50g/l, H2O, 20℃)(slurry) |
| Water Solubility | insoluble H2O, dilute acids and alkali hydroxides [HAW93] |
| Dielectric constant | 1.8 - 2.8（0.0℃） |
| Stability | Stable. Substances to be avoided include strong oxidizing agents. |
| InChI | InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
| InChIKey | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| SMILES | [Si](=O)(O[Al]=O)O[Si](=O)O[Al]=O.O.O |
| Indirect Additives used in Food Contact Substances | CLAY (KAOLIN) |
| SCOGS (Select Committee on GRAS Substances) | Clay (kaolin) (packaging) |
| FDA 21 CFR | 335.10; 346.14 |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H319-H315 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| OEB | B | |||||||||
| OEL | TWA: 10 mg/m3 (total) | |||||||||
| WGK Germany | - | |||||||||
| RTECS | GF1670500 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 25070090 | |||||||||
| Hazardous Substances Data | 1332-58-7(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
