| Melting point |
1750 °C |
| Density |
2,6 g/cm3 |
| refractive index |
1.6200 |
| storage temp. |
no restrictions. |
| solubility |
Practically insoluble in diethyl ether, ethanol (95%),
water, other organic solvents, cold dilute acids, and solutions of
alkali hydroxides. |
| form |
Powder |
| color |
75-96, Hunter Brightness |
| PH |
6-7 (50g/l, H2O, 20℃)(slurry) |
| Water Solubility |
insoluble H2O, dilute acids and alkali hydroxides [HAW93] |
| Dielectric constant |
1.8 - 2.8（0.0℃） |
| Stability |
Stable. Substances to be avoided include strong oxidizing agents. |
| InChI |
InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
| InChIKey |
NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| SMILES |
[Si](=O)(O[Al]=O)O[Si](=O)O[Al]=O.O.O |
| EPA Substance Registry System |
Kaolin (1332-58-7) |
