97-52-9
| Name | 2-Methoxy-4-nitroaniline |
| CAS | 97-52-9 |
| EINECS(EC#) | 202-588-6 |
| Molecular Formula | C7H8N2O3 |
| MDL Number | MFCD00007363 |
| Molecular Weight | 168.15 |
| MOL File | 97-52-9.mol |
Chemical Properties
| Appearance | yellow to orange crystalline powder |
| Melting point | 140-142 °C(lit.) |
| Boiling point | 337.07°C (rough estimate) |
| density | 1,211 g/cm3 |
| refractive index | 1.6010 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 0.2g/l |
| form | Crystalline Powder |
| pka | 1.02±0.10(Predicted) |
| color | Yellow to orange |
| PH | 6.2 (0.2g/l, H2O, 20℃) |
| Water Solubility | slightly soluble |
| BRN | 879619 |
| InChI | 1S/C7H8N2O3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,8H2,1H3 |
| InChIKey | GVBHRNIWBGTNQA-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1N)[N+]([O-])=O |
| CAS DataBase Reference | 97-52-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2-methoxy-4-nitro-(97-52-9) |
| EPA Substance Registry System | 97-52-9(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H351-H411 |
| Precautionary statements | P202-P264-P270-P273-P301+P312-P308+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | BZ7170000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 |