
93777-26-5
| Name | 5-Bromo-2-fluorobenzaldehyde |
| CAS | 93777-26-5 |
| EINECS(EC#) | 298-056-6 |
| Molecular Formula | C7H4BrFO |
| MDL Number | MFCD00070755 |
| Molecular Weight | 203.01 |
| MOL File | 93777-26-5.mol |
Chemical Properties
| Appearance | clear yellowish liquid after melting |
| Melting point | 58-62°C |
| Boiling point | 230 °C (lit.) |
| density | 1.71 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 229 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Specific Gravity | 1.710 |
| Water Solubility | INSOLUBLE |
| Sensitive | Air Sensitive |
| BRN | 7632798 |
| InChI | InChI=1S/C7H4BrFO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
| InChIKey | MMFGGDVQLQQQRX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Br)=CC=C1F |
| CAS DataBase Reference | 93777-26-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
