77771-02-9
| Name | 3-Bromo-4-fluorobenzaldehyde |
| CAS | 77771-02-9 |
| EINECS(EC#) | 278-764-1 |
| Molecular Formula | C7H4BrFO |
| MDL Number | MFCD00042186 |
| Molecular Weight | 203.01 |
| MOL File | 77771-02-9.mol |
Chemical Properties
| Appearance | white to light yellow low melting solid |
| Melting point | 31-33 °C (lit.) |
| Boiling point | 138-139 °C/2.5 mmHg (lit.) |
| density | 1.6698 (rough estimate) |
| refractive index | 1.574 |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Low Melting Solid |
| color | White to light yellow |
| Water Solubility | INSOLUBLE |
| Sensitive | Air Sensitive |
| BRN | 5806226 |
| InChI | InChI=1S/C7H4BrFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H |
| InChIKey | FAHZIKXYYRGSHF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C(Br)=C1 |
| CAS DataBase Reference | 77771-02-9(CAS DataBase Reference) |
| EPA Substance Registry System | 77771-02-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |