
932-30-9
| Name | 2-Hydroxybenzylamine |
| CAS | 932-30-9 |
| EINECS(EC#) | 213-249-7 |
| Molecular Formula | C7H9NO |
| MDL Number | MFCD03426060 |
| Molecular Weight | 123.15 |
| MOL File | 932-30-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 127 °C |
| Boiling point | 245.0±15.0 °C(Predicted) |
| density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | 8.63±0.35(Predicted) |
| color | Beige to Brown |
| InChI | InChI=1S/C7H9NO/c8-5-6-3-1-2-4-7(6)9/h1-4,9H,5,8H2 |
| InChIKey | KPRZOPQOBJRYSW-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC=C1CN |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
