90-72-2
| Name | Tris(dimethylaminomethyl)phenol |
| CAS | 90-72-2 |
| EINECS(EC#) | 202-013-9 |
| Molecular Formula | C15H27N3O |
| MDL Number | MFCD00008330 |
| Molecular Weight | 265.39 |
| MOL File | 90-72-2.mol |
Chemical Properties
| Melting point | 316℃ |
| Boiling point | 130-135 °C/1 mmHg (lit.) |
| density | 0.969 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | <0.01 mm Hg ( 21 °C) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in water |
| form | clear liquid |
| pka | 6.27±0.50(Predicted) |
| color | White to Yellow to Green |
| Odor | Amine odor |
| Water Solubility | 850g/L at 20℃ |
| BRN | 795751 |
| InChI | 1S/C15H27N3O/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6/h7-8,19H,9-11H2,1-6H3 |
| InChIKey | AHDSRXYHVZECER-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(CN(C)C)c(O)c(CN(C)C)c1 |
| LogP | -0.66 at 21.5℃ |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 1 |
| RTECS | SN3500000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29222900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 90-72-2(Hazardous Substances Data) |
| Toxicity |