
89226-75-5
| Name | Manidipine hydrochloride |
| CAS | 89226-75-5 |
| EINECS(EC#) | 680-304-3 |
| Molecular Formula | C35H40Cl2N4O6 |
| MDL Number | MFCD00896434 |
| Molecular Weight | 683.62 |
| MOL File | 89226-75-5.mol |
Chemical Properties
| Melting point | 157-163°; mp 174-180°; mp 167-170° |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in DMSO (>25 mg/ml) |
| form | solid |
| color | White |
| Water Solubility | Soluble in DMSO. Slightly soluble in water and ethanol /n |
| Merck | 14,5743 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChIKey | UFIXGLLGFBWKAV-UHFFFAOYSA-N |
| SMILES | C1(C)NC(C)=C(C(OCCN2CCN(C(C3=CC=CC=C3)C3=CC=CC=C3)CC2)=O)C(C2=CC=CC([N+]([O-])=O)=C2)C=1C(OC)=O.[H]Cl |
| CAS DataBase Reference | 89226-75-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H336 |
| Precautionary statements | P261-P264-P301+P310+P330-P304+P340+P312-P403+P233-P501 |
| RIDADR | UN 2811 6.1/PG III |
| RTECS | US7975300 |
| HS Code | 2933.59.8000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Toxicity |
