84942-40-5
| Name | 5'-Chloro-2'-hydroxy-3'-nitroacetophenone |
| CAS | 84942-40-5 |
| Molecular Formula | C8H6ClNO4 |
| MDL Number | MFCD01631131 |
| Molecular Weight | 215.59 |
| MOL File | 84942-40-5.mol |
Chemical Properties
| Melting point | 132-135 °C(lit.) |
| storage temp. | RT, stored under nitrogen |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | 1S/C8H6ClNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChIKey | IUNBIQBAYUBIFD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)cc(c1O)[N+]([O-])=O |
| CAS DataBase Reference | 84942-40-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |