
816-40-0
| Name | 1-BROMO-2-BUTANONE |
| CAS | 816-40-0 |
| EINECS(EC#) | 212-431-3 |
| Molecular Formula | C4H7BrO |
| MDL Number | MFCD00000207 |
| Molecular Weight | 151 |
| MOL File | 816-40-0.mol |
Chemical Properties
| Appearance | colorless to light yellow liquid |
| Boiling point | 105 °C150 mm Hg(lit.) |
| density | 1.479 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 155 °F |
| storage temp. | Keep Cold |
| form | Liquid |
| color | Colorless to light yellow |
| Specific Gravity | 1.479 |
| Sensitive | Lachrymatory |
| BRN | 741894 |
| InChI | InChI=1S/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
| InChIKey | CCXQVBSQUQCEEO-UHFFFAOYSA-N |
| SMILES | C(Br)C(=O)CC |
| CAS DataBase Reference | 816-40-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1693 |
| WGK Germany | 3 |
| RTECS | EL7000000 |
| Hazard Note | Harmful/Irritant/Lachrymatory |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |