814-75-5
| Name | 3-BROMO-2-BUTANONE |
| CAS | 814-75-5 |
| EINECS(EC#) | 212-404-6 |
| Molecular Formula | C4H7BrO |
| MDL Number | MFCD00013538 |
| Molecular Weight | 151 |
| MOL File | 814-75-5.mol |
Chemical Properties
| Appearance | clear light yellow to brown liquid |
| Boiling point | 36 °C (11 mmHg) |
| density | 1.416 g/mL at 25 °C |
| refractive index | 1.458-1.46 |
| Fp | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | Miscible with dichloromethane. |
| form | Liquid |
| color | Clear light yellow to brown |
| BRN | 906773 |
| InChI | InChI=1S/C4H7BrO/c1-3(5)4(2)6/h3H,1-2H3 |
| InChIKey | BNBOUFHCTIFWHN-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Br)C |
| CAS DataBase Reference | 814-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, 3-bromo- (814-75-5) |
Safety Data
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302+H312-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1224 |
| WGK Germany | 2 |
| RTECS | EL7005000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |