
7742-73-6
| Name | 1,3-Dichloroisoquinoline |
| CAS | 7742-73-6 |
| EINECS(EC#) | 627-814-4 |
| Molecular Formula | C9H5Cl2N |
| MDL Number | MFCD00034750 |
| Molecular Weight | 198.05 |
| MOL File | 7742-73-6.mol |
Chemical Properties
| Appearance | White to brown crystalline powder |
| Melting point | 121-122 °C (lit.) |
| Boiling point | 307°C(lit.) |
| density | 1.407±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.49±0.50(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C9H5Cl2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H |
| InChIKey | BRGZEQXWZWBPJH-UHFFFAOYSA-N |
| SMILES | C1(Cl)C2=C(C=CC=C2)C=C(Cl)N=1 |
| CAS DataBase Reference | 7742-73-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
