
71071-46-0
| Name | 4,4'-Bis(methoxycarbonly)-2,2'-bipyridine |
| CAS | 71071-46-0 |
| Molecular Formula | C14H12N2O4 |
| MDL Number | MFCD02669916 |
| Molecular Weight | 272.26 |
| MOL File | 71071-46-0.mol |
Chemical Properties
| Melting point | 208.0 to 212.0 °C |
| Boiling point | 440.8±45.0 °C(Predicted) |
| density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 1.85±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C14H12N2O4/c1-19-13(17)9-3-5-15-11(7-9)12-8-10(4-6-16-12)14(18)20-2/h3-8H,1-2H3 |
| InChIKey | HBWBVIDKBKOVEX-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C(OC)=O)=C2)=NC=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 71071-46-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

