
6813-38-3
| Name | 2,2'-Bipyridine-4,4'-dicarboxylic acid |
| CAS | 6813-38-3 |
| EINECS(EC#) | 626-224-4 |
| Molecular Formula | C12H8N2O4 |
| MDL Number | MFCD00015430 |
| Molecular Weight | 244.2 |
| MOL File | 6813-38-3.mol |
Chemical Properties
| Appearance | white to white-grey powder |
| Melting point | >310°C |
| Boiling point | 387.12°C (rough estimate) |
| density | 1.3468 (rough estimate) |
| refractive index | 1.6360 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 1.67±0.10(Predicted) |
| color | White to white-gray |
| Water Solubility | insoluble |
| BRN | 212894 |
| InChI | InChI=1S/C12H8N2O4/c15-11(16)7-1-3-13-9(5-7)10-6-8(12(17)18)2-4-14-10/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | FXPLCAKVOYHAJA-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C(O)=O)=C2)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 6813-38-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
