700-84-5
| Name | 5-Fluoro-1-indanone |
| CAS | 700-84-5 |
| Molecular Formula | C9H7FO |
| MDL Number | MFCD00041031 |
| Molecular Weight | 150.15 |
| MOL File | 700-84-5.mol |
Chemical Properties
| Appearance | white to yellowish crystalline low melting solid |
| Melting point | 38-40 °C (lit.) |
| Boiling point | 113-114 °C (lit.) |
| density | 1.216 g/mL at 25 °C(lit.) |
| Fp | >230 °F |
| storage temp. | Refrigerator |
| form | Crystalline Low Melting Solid |
| color | White to yellow |
| Specific Gravity | 1.216 |
| Water Solubility | insoluble |
| BRN | 1617799 |
| InChI | InChI=1S/C9H7FO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5H,1,4H2 |
| InChIKey | WVPPBVAMKNQXJA-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(F)C=C2)CC1 |
| CAS DataBase Reference | 700-84-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |