699-99-0
| Name | 4-Fluoro-1-indanone |
| CAS | 699-99-0 |
| Molecular Formula | C9H7FO |
| MDL Number | MFCD00797829 |
| Molecular Weight | 150.15 |
| MOL File | 699-99-0.mol |
Chemical Properties
| Melting point | 72-76 °C |
| Boiling point | 242.8±29.0 °C(Predicted) |
| density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in alcohol and chloroform |
| form | solid |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C9H7FO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 |
| InChIKey | HOMSJDBZHCPYHY-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(F)=CC=C2)CC1 |
| CAS DataBase Reference | 699-99-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |