68909-20-6
| Name | SILICA |
| CAS | 68909-20-6 |
| EINECS(EC#) | 272-697-1 |
| Molecular Formula | O2Si |
| MDL Number | MFCD00011232 |
| Molecular Weight | 60.08 |
| MOL File | 68909-20-6.mol |
Chemical Properties
| Melting point | 1610 °C(lit.) |
| Boiling point | >100 °C(lit.) |
| density | 2.6 g/mL at 25 °C(lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| form | tablets (~0.5 g each) |
| color | White with some blue indicating granules |
| Specific Gravity | 2.2 |
| Hydrolytic Sensitivity | 5: forms reversible hydrate |
| Dielectric constant | 2.5-3.5（0.0℃） |
| Major Application | glass & ceramic industrial qc pharmaceutical |
| InChI | InChI=1S/C6H19NSi2.O2Si/c1-8(2,3)7-9(4,5)6;1-3-2/h7H,1-6H3; |
| InChIKey | SVOGQRMBDCQOJU-UHFFFAOYSA-N |
| SMILES | N([Si](C)(C)C)[Si](C)(C)C.[Si](=O)=O |
| EPA Substance Registry System | Hydrolysis products of 1,1,1-trimethyl-N-(trimethylsilyl)silanamine with silica (68909-20-6) |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H373 |
| Precautionary statements | P260-P314-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VV7340000 |
| F | 3 |
| TSCA | Yes |
| Storage Class | 10 - Combustible liquids |