
6809-52-5
| Name | Teprenone |
| CAS | 6809-52-5 |
| EINECS(EC#) | 614-276-0 |
| Molecular Formula | C46H76O2 |
| MDL Number | MFCD00866901 |
| Molecular Weight | 661.09 |
| MOL File | 6809-52-5.mol |
Chemical Properties
| Boiling point | bp0.01 155-160° |
| density | d420.5 0.9081 |
| refractive index | nD20 1.4947 |
| storage temp. | -20°C |
| solubility | DMSO: >5mg/mL |
| form | liquid |
| color | clear |
| Merck | 14,9228 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C23H38O/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h11,13,15,17H,7-10,12,14,16,18H2,1-6H3 |
| InChIKey | SBOCYPUKNYDTSX-DMLVRTFPSA-N |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)CCC=C(C)CC/C=C(/C)\C |
| LogP | 8.200 (est) |
| CAS DataBase Reference | 6809-52-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| RTECS | RA5391300 |
| HS Code | 2914.19.0000 |
| REACH Registrations | Active |
| Storage Class | 10 - Combustible liquids |
