
16320-04-0
Name | Gestrinone |
CAS | 16320-04-0 |
EINECS(EC#) | 685-143-2 |
Molecular Formula | C21H24O2 |
MDL Number | MFCD00865561 |
Molecular Weight | 308.41 |
MOL File | 16320-04-0.mol |
Chemical Properties
Melting point | 150-152°C |
alpha | D20 +84.6° (c = 0.41 in methanol) |
Boiling point | 388.8°C (rough estimate) |
density | 1.1040 (rough estimate) |
refractive index | 1.4900 (estimate) |
storage temp. | -20°C Freezer |
solubility | DMF:20.0(Max Conc. mg/mL);64.85(Max Conc. mM) DMSO:35.0(Max Conc. mg/mL);113.48(Max Conc. mM) Ethanol:20.0(Max Conc. mg/mL);64.85(Max Conc. mM) Ethanol:PBS (pH 7.2) (1:5):0.25(Max Conc. mg/mL);81.06(Max Conc. mM) Water:1.0(Max Conc. mg/mL);3.24(Max Conc. mM) |
form | A crystalline solid |
pka | 12.76±0.40(Predicted) |
color | Off-white to light yellow |
optical activity | [α]/D +81 to +88°, c =0.4 in ethanol |
Merck | 14,4415 |
Stability: | Hygroscopic |
InChI | InChI=1S/C21H24O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,9,11,13,18-19,23H,3,5-8,10,12H2,1H3/t18-,19+,20+,21+/m1/s1 |
InChIKey | BJJXHLWLUDYTGC-ANULTFPQSA-N |
SMILES | C1C2C(CC[C@]3([H])C=2C=C[C@@]2(CC)[C@@]3([H])CC[C@]2(C#C)O)=CC(=O)C1 |
CAS DataBase Reference | 16320-04-0(CAS DataBase Reference) |