
63-05-8
| Name | Androstenedione |
| CAS | 63-05-8 |
| EINECS(EC#) | 200-554-5 |
| Molecular Formula | C19H26O2 |
| MDL Number | MFCD00003615 |
| Molecular Weight | 286.41 |
| MOL File | 63-05-8.mol |
Chemical Properties
| Appearance | White to Off-White Solid |
| Melting point | 170-171 °C(lit.) |
| alpha | D30 +199° (in chloroform) |
| Boiling point | 368.77°C (rough estimate) |
| density | 1.0655 (rough estimate) |
| refractive index | 1.4709 (estimate) |
| Fp | 2℃ |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Sparingly) |
| form | Solid |
| color | Dimorphous: Needles from acetone, or crystalsfrom hexane |
| Water Solubility | 57.28mg/L(25 ºC) |
| Usage | Testosterone precursor and metabolite with androgenic activity. Controlled substance (anabolic sterid) |
| Merck | 13,643 |
| Henry's Law Constant | 2.7×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | AEMFNILZOJDQLW-QAGGRKNESA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]4(C)C(=O)CC[C@@]24[H] |
| CAS DataBase Reference | 63-05-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P261-P280-P305+P351+P338-P370+P378-P403+P235 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | BV8150000 |
| REACH Registrations | Active |
| HS Code | 29372900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1A |
| Hazardous Substances Data | 63-05-8(Hazardous Substances Data) |

