
6702-50-7
| Name | Methyl 3-hydroxy-4-methoxybenzoate |
| CAS | 6702-50-7 |
| Molecular Formula | C9H10O4 |
| MDL Number | MFCD01321262 |
| Molecular Weight | 182.17 |
| MOL File | 6702-50-7.mol |
Chemical Properties
| Appearance | Off-white to beige crystalline powder |
| Melting point | 64-67 °C(lit.) |
| Boiling point | 102 °C(Press: 0.1 Torr) |
| density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 9.15±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C9H10O4/c1-12-8-4-3-6(5-7(8)10)9(11)13-2/h3-5,10H,1-2H3 |
| InChIKey | QXOXUEFXRSIYSW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(OC)C(O)=C1 |
| LogP | 1.750 (est) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
