
65896-11-9
| Name | 2-BROMO-6-FLUOROANILINE |
| CAS | 65896-11-9 |
| EINECS(EC#) | 464-930-2 |
| Molecular Formula | C6H5BrFN |
| MDL Number | MFCD01310982 |
| Molecular Weight | 190.01 |
| MOL File | 65896-11-9.mol |
Chemical Properties
| Appearance | Clear yellow to brown liquid |
| Boiling point | 211.0±20.0 °C(Predicted) |
| density | 1.674 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | 82° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Liquid |
| pka | 1.15±0.10(Predicted) |
| color | Clear yellow to brown |
| BRN | 8541957 |
| InChI | InChI=1S/C6H5BrFN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| InChIKey | ALZFPYUPNVLVQM-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=CC=C1Br |
| CAS DataBase Reference | 65896-11-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302-H312-H331 |
| Precautionary statements | P280-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

