367-24-8
| Name | 4-Bromo-2-fluoroaniline |
| CAS | 367-24-8 |
| EINECS(EC#) | 206-685-4 |
| Molecular Formula | C6H5BrFN |
| MDL Number | MFCD00010221 |
| Molecular Weight | 190.01 |
| MOL File | 367-24-8.mol |
Chemical Properties
| Appearance | solid |
| Melting point | 40-42 °C |
| Boiling point | 103-108 °C (13 mmHg) |
| density | 1.6196 (rough estimate) |
| refractive index | 1.4710 (estimate) |
| Fp | 220 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Mass, Powder, Crystals and/or Chunks |
| pka | 2.50±0.10(Predicted) |
| color | Beige to light brown to brown-gray or gray |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, strong acids, strong oxidizing agents. |
| Detection Methods | HPLC |
| BRN | 2081089 |
| InChI | InChI=1S/C6H5BrFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | GZRMNMGWNKSANY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 367-24-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-2-fluoroaniline(367-24-8) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
