444-14-4
| Name | 2-Bromo-4,6-difluoroaniline |
| CAS | 444-14-4 |
| EINECS(EC#) | 429-430-0 |
| Molecular Formula | C6H4BrF2N |
| MDL Number | MFCD00009639 |
| Molecular Weight | 208 |
| MOL File | 444-14-4.mol |
Chemical Properties
| Appearance | white crystalline low melting solid |
| Melting point | 41-42 °C (lit.) |
| Boiling point | 208.0±35.0 °C(Predicted) |
| density | 1.6953 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| Fp | 177 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 1.20±0.10(Predicted) |
| color | White to Green to Brown |
| Water Solubility | Insoluble in water. |
| BRN | 2718139 |
| InChI | InChI=1S/C6H4BrF2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| InChIKey | WUJKFVGKLTWVSQ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=C(F)C=C1Br |
| CAS DataBase Reference | 444-14-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| HazardClass | 9 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |