
112279-60-4
| Name | 4-BROMO-2,5-DIFLUOROANILINE |
| CAS | 112279-60-4 |
| EINECS(EC#) | 625-718-7 |
| Molecular Formula | C6H4BrF2N |
| MDL Number | MFCD01861125 |
| Molecular Weight | 208 |
| MOL File | 112279-60-4.mol |
Chemical Properties
| Melting point | 74-78 °C (lit.) |
| Boiling point | 212.1±35.0 °C(Predicted) |
| density | 1.788±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.48±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 4741102 |
| InChI | InChI=1S/C6H4BrF2N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
| InChIKey | XOYHFIQPPOJMFK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(Br)C=C1F |
| CAS DataBase Reference | 112279-60-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |