656-65-5
| Name | 4-Bromo-3-fluoroaniline |
| CAS | 656-65-5 |
| EINECS(EC#) | 628-120-4 |
| Molecular Formula | C6H5BrFN |
| MDL Number | MFCD00672933 |
| Molecular Weight | 190.01 |
| MOL File | 656-65-5.mol |
Chemical Properties
| Appearance | Beige to brown needles and crystalline powder |
| Melting point | 72-73°C |
| Boiling point | 65-68 °C (lit.) |
| density | 0.982 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 105 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile, Methanol |
| form | Crystalline Powder |
| pka | 2.88±0.10(Predicted) |
| color | Yellow to tan |
| Water Solubility | Soluble in acetonitrile, methanol. Insoluble in water. |
| BRN | 3236457 |
| InChI | InChI=1S/C6H5BrFN/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| InChIKey | YTMVYYAKOPIJCZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(F)=C1 |
| CAS DataBase Reference | 656-65-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
