
65-19-0
| Name | Yohimbine hydrochloride |
| CAS | 65-19-0 |
| EINECS(EC#) | 200-600-4 |
| Molecular Formula | C21H27ClN2O3 |
| MDL Number | MFCD00012674 |
| Molecular Weight | 390.9 |
| MOL File | 65-19-0.mol |
Chemical Properties
| Appearance | white to slightly yellow powder |
| Melting point | 288-290 °C (dec.)(lit.) |
| alpha | 99 º (c=1%, H2O, dry subst) |
| refractive index | 103 ° (C=1, H2O) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O: 10 mg/mL |
| form | powder |
| color | white to off-white |
| Optical Rotation | [α]/D 100±5°, c = 1 in H2O |
| Water Solubility | H2O: 10mg/mL |
| Sensitive | Light Sensitive |
| Merck | 10102 |
| InChIKey | PIPZGJSEDRMUAW-VJDCAHTMSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1[C@@]1(C[C@]3([C@](CC[C@@H]([C@@H]3C(OC)=O)O)([H])CN1CC2)[H])[H].[H]Cl |&1:9,11,12,15,16,r| |
| LogP | 2.201 (est) |
| CAS DataBase Reference | 65-19-0(CAS DataBase Reference) |
| EPA Substance Registry System | 65-19-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P260-P264-P270-P271-P284-P304+P340+P310 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ZG1015000 |
| TSCA | Yes |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29339900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |

;