634-97-9
| Name | Pyrrole-2-carboxylic acid |
| CAS | 634-97-9 |
| EINECS(EC#) | 211-221-9 |
| Molecular Formula | C5H5NO2 |
| MDL Number | MFCD00005219 |
| Molecular Weight | 111.1 |
| MOL File | 634-97-9.mol |
Chemical Properties
| Appearance | Light brown powder |
| Melting point | 204-208 °C (dec.) (lit.) |
| Boiling point | 340.3±15.0 °C(Predicted) |
| density | 0.862 |
| refractive index | 1.441-1.445 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Powder |
| pka | 4.45(at 20℃) |
| color | White to off-white to pale pink |
| BRN | 80825 |
| InChI | InChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8) |
| InChIKey | WRHZVMBBRYBTKZ-UHFFFAOYSA-N |
| SMILES | N1C=CC=C1C(O)=O |
| CAS DataBase Reference | 634-97-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyrrole-2-carboxylic acid(634-97-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |