621-07-8
| Name | N,N-Dibenzylhydroxylamine |
| CAS | 621-07-8 |
| EINECS(EC#) | 210-667-1 |
| Molecular Formula | C14H15NO |
| MDL Number | MFCD00004772 |
| Molecular Weight | 213.27 |
| MOL File | 621-07-8.mol |
Chemical Properties
| Appearance | white to slightly yellow adhering crystalline |
| Melting point | 125-128 °C (lit.) |
| Boiling point | 353.27°C (rough estimate) |
| density | 1.0439 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 13.19±0.69(Predicted) |
| color | White to Almost white |
| BRN | 978234 |
| InChI | InChI=1S/C14H15NO/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | GXELTROTKVKZBQ-UHFFFAOYSA-N |
| SMILES | C1(CN(O)CC2=CC=CC=C2)=CC=CC=C1 |
| CAS DataBase Reference | 621-07-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Hydroxylamine, n,n-dibenzyl-,(621-07-8) |
| EPA Substance Registry System | 621-07-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2928.00.2500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |