
620-92-8
| Name | 4,4'-DIHYDROXYDIPHENYLMETHANE |
| CAS | 620-92-8 |
| EINECS(EC#) | 210-658-2 |
| Molecular Formula | C13H12O2 |
| MDL Number | MFCD00002385 |
| Molecular Weight | 200.23 |
| MOL File | 620-92-8.mol |
Chemical Properties
| Melting point | 162-164 °C |
| Boiling point | 297.96°C (rough estimate) |
| density | 1.0907 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 9.91±0.10(Predicted) |
| color | Off-White to Light Red |
| Water Solubility | It is soluble in ethanol, ether, chloroform, alkali; slightly soluble in DMSO, insoluble in carbon disulfide and water. |
| BRN | 2049425 |
| InChI | InChI=1S/C13H12O2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8,14-15H,9H2 |
| Contact allergens | |
| InChIKey | PXKLMJQFEQBVLD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| CAS DataBase Reference | 620-92-8(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4,4'-methylenebis- (620-92-8) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | SL9625000 |
| TSCA | Yes |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 620-92-8(Hazardous Substances Data) |
| Toxicity |
