115-41-3
| Name | Pyrocatechol Violet |
| CAS | 115-41-3 |
| EINECS(EC#) | 204-088-3 |
| Molecular Formula | C19H14O7S |
| MDL Number | MFCD00005868 |
| Molecular Weight | 386.38 |
| MOL File | 115-41-3.mol |
Chemical Properties
| Appearance | greenish yellow powder |
| Melting point | 185 °C (dec.)(lit.) |
| Boiling point | 659.5±55.0 °C(Predicted) |
| density | 1.632±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | H2O: 1 mg/mL, clear, red |
| form | Metallic or Crystalline Powder |
| pka | 7.21±0.10(Predicted) |
| color | Dark red-brown |
| PH Range | 6.0(YELLOW)-7.0(PURPLE)-9.0(PURPLISH RED) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Soluble in water, ethylene glycol, monomethyl ether and ethanol. |
| BRN | 353938 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C19H14O7S/c20-14-7-5-11(9-16(14)22)19(12-6-8-15(21)17(23)10-12)13-3-1-2-4-18(13)27(24,25)26/h1-10,20,22-23H,(H,24,25,26)/b19-12+ |
| InChIKey | HGPSVOAVAYJEIJ-XDHOZWIPSA-N |
| SMILES | Oc1ccc(cc1O)C(=C2\C=CC(=O)C(O)=C2)\c3ccccc3S(O)(=O)=O |
| CAS DataBase Reference | 115-41-3(CAS DataBase Reference) |
| EPA Substance Registry System | 115-41-3(EPA Substance) |