5959-52-4
| Name | 3-Amino-2-naphthoic acid |
| CAS | 5959-52-4 |
| EINECS(EC#) | 227-726-2 |
| Molecular Formula | C11H9NO2 |
| MDL Number | MFCD00004115 |
| Molecular Weight | 187.19 |
| MOL File | 5959-52-4.mol |
Chemical Properties
| Appearance | yellow-green to green powder |
| Melting point | 212-215 °C (dec.) (lit.) |
| Boiling point | 321.94°C (rough estimate) |
| density | 1.1963 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 2.20±0.30(Predicted) |
| color | Yellow-green to green |
| Water Solubility | Soluble in alcohol and ether. Insoluble in water. |
| Merck | 14,452 |
| BRN | 744099 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H9NO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6H,12H2,(H,13,14) |
| InChIKey | XFXOLBNQYFRSLQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(N)=C1C(O)=O |
| CAS DataBase Reference | 5959-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | 5959-52-4(EPA Substance) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QL1400000 |
| TSCA | Yes |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |