5794-88-7
| Name | 2-Amino-5-bromobenzoic acid |
| CAS | 5794-88-7 |
| EINECS(EC#) | 227-338-3 |
| Molecular Formula | C7H6BrNO2 |
| MDL Number | MFCD00007823 |
| Molecular Weight | 216.03 |
| MOL File | 5794-88-7.mol |
Chemical Properties
| Appearance | slight yellow to white powder |
| Melting point | 213-215 °C (lit.) |
| Boiling point | 265.51°C (rough estimate) |
| density | 1.6841 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in methanol and dimethyl sulfoxide. |
| form | Powder |
| pka | 4.55±0.10(Predicted) |
| color | Beige |
| Sensitive | Light Sensitive |
| Merck | 14,1405 |
| BRN | 639028 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6BrNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | CUKXRHLWPSBCTI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1N |
| CAS DataBase Reference | 5794-88-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-5-bromobenzoic acid(5794-88-7) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CB2557670 |
| Hazard Note | Harmful |
| PackingGroup | 6.1/PG 3 |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |