575-03-1
| Name | 7-HYDROXY-4-(TRIFLUOROMETHYL)COUMARIN |
| CAS | 575-03-1 |
| EINECS(EC#) | 124-586-5 |
| Molecular Formula | C10H5F3O3 |
| MDL Number | MFCD00037578 |
| Molecular Weight | 230.14 |
| MOL File | 575-03-1.mol |
Chemical Properties
| Appearance | Off-white to light yellow or pink powder |
| Melting point | 178-180 °C (lit.) |
| Boiling point | 311.4±42.0 °C(Predicted) |
| density | 1.4435 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.23±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 330nm(Toluene)(lit.) |
| Detection Methods | HPLC,NMR |
| BRN | 210932 |
| InChI | InChI=1S/C10H5F3O3/c11-10(12,13)7-4-9(15)16-8-3-5(14)1-2-6(7)8/h1-4,14H |
| InChIKey | CCKWMCUOHJAVOL-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 575-03-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 8-10 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29322090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
