
571-58-4
| Name | 1,4-DIMETHYLNAPHTHALENE |
| CAS | 571-58-4 |
| EINECS(EC#) | 209-335-9 |
| Molecular Formula | C12H12 |
| MDL Number | MFCD00004037 |
| Molecular Weight | 156.22 |
| MOL File | 571-58-4.mol |
Chemical Properties
| Melting point | -18 °C (lit.) |
| Boiling point | 262-264 °C/751 mmHg (lit.) |
| density | 1.016 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | neat |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 9.634mg/L(25 ºC) |
| BRN | 2039842 |
| Henry's Law Constant | 2.6×10-2 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/C12H12/c1-9-7-8-10(2)12-6-4-3-5-11(9)12/h3-8H,1-2H3 |
| InChIKey | APQSQLNWAIULLK-UHFFFAOYSA-N |
| SMILES | C1(C)=C2C(C=CC=C2)=C(C)C=C1 |
| LogP | 4.370 |
| CAS DataBase Reference | 571-58-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Dimethylnaphthalene (571-58-4) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H304-H319-H410 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P273-P391-P501 |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QJ4440000 |
| HS Code | 2902.90.9000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 3 Asp. Tox. 1 Eye Irrit. 2 |


