605-70-9
| Name | 1,4-Naphthalenedicarboxylic acid |
| CAS | 605-70-9 |
| EINECS(EC#) | 210-094-7 |
| Molecular Formula | C12H8O4 |
| MDL Number | MFCD00014312 |
| Molecular Weight | 216.19 |
| MOL File | 605-70-9.mol |
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 490.2±28.0 °C(Predicted) |
| density | 1.54 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.71±0.10(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| BRN | 2051255 |
| InChI | InChI=1S/C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C(C=CC=C2)=C(C(O)=O)C=C1 |
| CAS DataBase Reference | 605-70-9(CAS DataBase Reference) |
| EPA Substance Registry System | 605-70-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |