
771-97-1
| Name | 2,3-DIAMINONAPHTHALENE |
| CAS | 771-97-1 |
| EINECS(EC#) | 212-241-0 |
| Molecular Formula | C10H10N2 |
| MDL Number | MFCD00004116 |
| Molecular Weight | 158.2 |
| MOL File | 771-97-1.mol |
Chemical Properties
| Appearance | colourless to white crystalline powder |
| Melting point | 197-203 °C |
| Boiling point | 273.29°C (rough estimate) |
| density | 1.0968 |
| refractive index | 1.6392 (estimate) |
| storage temp. | Refrigerator |
| solubility | pyridine: soluble50mg/mL |
| form | Crystalline Powder |
| pka | 5.36±0.10(Predicted) |
| color | Green-brown to brown |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | Slightly soluble in water. Soluble in pyridine, dimethylsulfoxide, dimethyformamide, dil.hydrochloric acid, ethanol, ether and hot methanol. |
| BRN | 2206394 |
| InChI | InChI=1S/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
| InChIKey | XTBLDMQMUSHDEN-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(N)=C1N |
| Uses | |
| CAS DataBase Reference | 771-97-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3-Naphthalenediamine (771-97-1) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H335-H350 |
| Precautionary statements | P201-P202-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | Yes |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


