1,4-Naphthalenedicarboxylic acid
- Product Name1,4-Naphthalenedicarboxylic acid
- CAS605-70-9
- MFC12H8O4
- MW216.19
- EINECS210-094-7
- MOL File605-70-9.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 490.2±28.0 °C(Predicted) |
| Density | 1.54 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.71±0.10(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| BRN | 2051255 |
| InChI | InChI=1S/C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C(C=CC=C2)=C(C(O)=O)C=C1 |
| CAS DataBase Reference | 605-70-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Naphthalenedicarboxylic acid (605-70-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
