
5433-01-2
| Name | 3-Bromocumene |
| CAS | 5433-01-2 |
| Molecular Formula | C9H11Br |
| MDL Number | MFCD01318112 |
| Molecular Weight | 199.09 |
| MOL File | 5433-01-2.mol |
Chemical Properties
| Melting point | -10°C (estimate) |
| Boiling point | 52-53°C 0,8mm |
| density | 1,285 g/cm3 |
| refractive index | 1.5302 |
| Fp | 52-53°C/0.8mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Difficult to mix in water. |
| BRN | 1858092 |
| InChI | InChI=1S/C9H11Br/c1-7(2)8-4-3-5-9(10)6-8/h3-7H,1-2H3 |
| InChIKey | GBSGGFCCQZUXNB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C(C)C)=C1 |
| CAS DataBase Reference | 5433-01-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313-P210-P280-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3082 |
| WGK Germany | WGK 3 |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
