5407-04-5
| Name | 3-Dimethylaminopropylchloride hydrochloride |
| CAS | 5407-04-5 |
| EINECS(EC#) | 224-971-7 |
| Molecular Formula | C5H13Cl2N |
| MDL Number | MFCD00012534 |
| Molecular Weight | 158.07 |
| MOL File | 5407-04-5.mol |
Chemical Properties
| Appearance | White to yellowish crystalline powder |
| Melting point | 187-190 °C(lit.) |
| Boiling point | 50 °C(Press: 40 Torr) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 2000g/l |
| form | Solid |
| color | White to Off-White |
| PH | 5-6 (500g/l, H2O, 20℃) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Usage | 3-Chloro-N,N-dimethylpropylamine hydrochloride (DMPC) is used as intermediate for the syntheses of pharmaceuticals (e.g. amitriptyline, bencyclane, benzydamine, cyclobenzaprine and imipramine). Product Data Sheet |
| BRN | 3670046 |
| InChI | InChI=1S/C5H12ClN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H |
| InChIKey | LJQNMDZRCXJETK-UHFFFAOYSA-N |
| SMILES | C(CCCl)N(C)C.Cl |
| CAS DataBase Reference | 5407-04-5(CAS DataBase Reference) |
| EPA Substance Registry System | 5407-04-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | TY1225000 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29211990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
