525-82-6
| Name | FLAVONE |
| CAS | 525-82-6 |
| EINECS(EC#) | 208-383-8 |
| Molecular Formula | C15H10O2 |
| MDL Number | MFCD00006825 |
| Molecular Weight | 222.24 |
| MOL File | 525-82-6.mol |
Chemical Properties
| Definition | One of a group of flavonoid plant pigments existing as colorless needles, that are insoluble in water and melting at 100C. It fluoresces violet in concentrated sulfuric acid. It can be synthesized. Treatment with alcoholic alkali yields flavanone. The fla |
| Appearance | white crystalline powder |
| Melting point | 94-97 °C (lit.) |
| Boiling point | 185 °C / 1mmHg |
| density | 1.1404 (rough estimate) |
| refractive index | 1.6600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | >38.3 mg/mL in EtOH; >52.3 mg/mL in DMSO |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in acetone (25 mg/ml), methanol, alcohol, and chloroform. Insoluble in water. |
| Merck | 14,4092 |
| BRN | 157598 |
| InChI | InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
| InChIKey | VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)OC2=CC=CC=C2C(=O)C=1 |
| LogP | 3.560 |
| CAS DataBase Reference | 525-82-6(CAS DataBase Reference) |
| EPA Substance Registry System | Flavone (525-82-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DJ3100630 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |